C25H31NO6 — CID 135055059
ditert-butyl (1R,2S,6S)-4-formyl-2-methyl-2'-oxospiro[cyclohex-3-ene-6,3'-indole]-1,1'-dicarboxylate (PubChem CID 135055059) has the molecular formula C25H31NO6 and a molecular weight of 441.52 g/mol. Its IUPAC name is ditert-butyl (1R,2S,6S)-4-formyl-2-methyl-2'-oxospiro[cyclohex-3-ene-6,3'-indole]-1,1'-dicarboxylate.
| Compound Name | ditert-butyl (1R,2S,6S)-4-formyl-2-methyl-2'-oxospiro[cyclohex-3-ene-6,3'-indole]-1,1'-dicarboxylate |
|---|---|
| PubChem CID | 135055059 |
| Molecular Formula | C25H31NO6 |
| Molecular Weight | 441.52 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | ditert-butyl (1R,2S,6S)-4-formyl-2-methyl-2'-oxospiro[cyclohex-3-ene-6,3'-indole]-1,1'-dicarboxylate |
| SMILES | C[C@H]1C=C(C=O)C[C@]2(C(=O)N(C(=O)OC(C)(C)C)c3ccccc32)[C@@H]1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H31NO6/c1-15-12-16(14-27)13-25(19(15)20(28)31-23(2,3)4)17-10-8-9-11-18(17)26(21(25)29)22(30)32-24(5,6)7/h8-12,14-15,19H,13H2,1-7H3/t15-,19-,25+/m0/s1 |
| InChIKey | ZSFWCNAWXJIJAV-AMBFMVRQSA-N |
| XLogP | 4.33 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.52 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|