C34H31NO — CID 135055491
(2R,3R)-2-(benzhydrylideneamino)-1-naphthalen-1-yl-3-phenylpentan-3-ol (PubChem CID 135055491) has the molecular formula C34H31NO and a molecular weight of 469.63 g/mol. Its IUPAC name is (2R,3R)-2-(benzhydrylideneamino)-1-naphthalen-1-yl-3-phenylpentan-3-ol.
| Compound Name | (2R,3R)-2-(benzhydrylideneamino)-1-naphthalen-1-yl-3-phenylpentan-3-ol |
|---|---|
| PubChem CID | 135055491 |
| Molecular Formula | C34H31NO |
| Molecular Weight | 469.63 g/mol |
| Exact Mass | 469.24 |
| IUPAC Name | (2R,3R)-2-(benzhydrylideneamino)-1-naphthalen-1-yl-3-phenylpentan-3-ol |
| SMILES | CC[C@@](O)(c1ccccc1)[C@@H](Cc1cccc2ccccc12)N=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H31NO/c1-2-34(36,30-22-10-5-11-23-30)32(25-29-21-14-20-26-15-12-13-24-31(26)29)35-33(27-16-6-3-7-17-27)28-18-8-4-9-19-28/h3-24,32,36H,2,25H2,1H3/t32-,34-/m1/s1 |
| InChIKey | AQZAEZMPFYKPQB-ZFEZZJPFSA-N |
| XLogP | 7.59 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.63 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|