C26H21NO — CID 139186315
(1R,2S)-1-phenyl-2-(pyren-1-ylmethylideneamino)propan-1-ol (PubChem CID 139186315) has the molecular formula C26H21NO and a molecular weight of 363.46 g/mol. Its IUPAC name is (1R,2S)-1-phenyl-2-(pyren-1-ylmethylideneamino)propan-1-ol.
| Compound Name | (1R,2S)-1-phenyl-2-(pyren-1-ylmethylideneamino)propan-1-ol |
|---|---|
| PubChem CID | 139186315 |
| Molecular Formula | C26H21NO |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | (1R,2S)-1-phenyl-2-(pyren-1-ylmethylideneamino)propan-1-ol |
| SMILES | C[C@H](/N=C/c1ccc2ccc3cccc4ccc1c2c34)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C26H21NO/c1-17(26(28)21-6-3-2-4-7-21)27-16-22-13-12-20-11-10-18-8-5-9-19-14-15-23(22)25(20)24(18)19/h2-17,26,28H,1H3/b27-16+/t17-,26-/m0/s1 |
| InChIKey | BSMGXLNCGIQRMX-DQNJRCKUSA-N |
| XLogP | 6.12 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|