C37H27NO — CID 155931216
(12R,13S)-13-[(E)-2-(benzhydrylideneamino)ethenyl]pentacyclo[12.8.0.02,11.03,8.017,22]docosa-1(14),2(11),3,5,7,9,15,17,19,21-decaen-12-ol (PubChem CID 155931216) has the molecular formula C37H27NO and a molecular weight of 501.63 g/mol. Its IUPAC name is (12R,13S)-13-[(E)-2-(benzhydrylideneamino)ethenyl]pentacyclo[12.8.0.02,11.03,8.017,22]docosa-1(14),2(11),3,5,7,9,15,17,19,21-decaen-12-ol.
| Compound Name | (12R,13S)-13-[(E)-2-(benzhydrylideneamino)ethenyl]pentacyclo[12.8.0.02,11.03,8.017,22]docosa-1(14),2(11),3,5,7,9,15,17,19,21-decaen-12-ol |
|---|---|
| PubChem CID | 155931216 |
| Molecular Formula | C37H27NO |
| Molecular Weight | 501.63 g/mol |
| Exact Mass | 501.21 |
| IUPAC Name | (12R,13S)-13-[(E)-2-(benzhydrylideneamino)ethenyl]pentacyclo[12.8.0.02,11.03,8.017,22]docosa-1(14),2(11),3,5,7,9,15,17,19,21-decaen-12-ol |
| SMILES | O[C@H]1c2ccc3ccccc3c2-c2c(ccc3ccccc23)[C@@H]1/C=C/N=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H27NO/c39-37-32(23-24-38-36(27-13-3-1-4-14-27)28-15-5-2-6-16-28)31-21-19-25-11-7-9-17-29(25)34(31)35-30-18-10-8-12-26(30)20-22-33(35)37/h1-24,32,37,39H/b24-23+/t32-,37+/m0/s1 |
| InChIKey | YUTDOVVYHNYBRX-XYCIHPRESA-N |
| XLogP | 8.84 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.63 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|