C29H23NO — CID 155931212
(9R,10S)-10-[(E)-2-(benzhydrylideneamino)ethenyl]-9,10-dihydrophenanthren-9-ol (PubChem CID 155931212) has the molecular formula C29H23NO and a molecular weight of 401.51 g/mol. Its IUPAC name is (9R,10S)-10-[(E)-2-(benzhydrylideneamino)ethenyl]-9,10-dihydrophenanthren-9-ol.
| Compound Name | (9R,10S)-10-[(E)-2-(benzhydrylideneamino)ethenyl]-9,10-dihydrophenanthren-9-ol |
|---|---|
| PubChem CID | 155931212 |
| Molecular Formula | C29H23NO |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | (9R,10S)-10-[(E)-2-(benzhydrylideneamino)ethenyl]-9,10-dihydrophenanthren-9-ol |
| SMILES | O[C@H]1c2ccccc2-c2ccccc2[C@@H]1/C=C/N=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H23NO/c31-29-26-18-10-9-16-24(26)23-15-7-8-17-25(23)27(29)19-20-30-28(21-11-3-1-4-12-21)22-13-5-2-6-14-22/h1-20,27,29,31H/b20-19+/t27-,29-/m0/s1 |
| InChIKey | BDHADYZZKACPQR-RFGZLLLXSA-N |
| XLogP | 6.54 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|