C19H12NO+ — CID 102381096
(4R)-4H-pyreno[1,2-b]pyridin-10-ium-4-ol (PubChem CID 102381096) has the molecular formula C19H12NO+ and a molecular weight of 270.31 g/mol. Its IUPAC name is (4R)-4H-pyreno[1,2-b]pyridin-10-ium-4-ol.
| Compound Name | (4R)-4H-pyreno[1,2-b]pyridin-10-ium-4-ol |
|---|---|
| PubChem CID | 102381096 |
| Molecular Formula | C19H12NO+ |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | (4R)-4H-pyreno[1,2-b]pyridin-10-ium-4-ol |
| SMILES | O[C@@H]1C=c2cc3c(c4ccc5cccc1c5c24)=[N+]=CC=C3 |
| InChI | InChI=1S/C19H12NO/c21-16-10-13-9-12-4-2-8-20-19(12)15-7-6-11-3-1-5-14(16)17(11)18(13)15/h1-10,16,21H/q+1/t16-/m1/s1 |
| InChIKey | OQNRQSCUHJPZGW-MRXNPFEDSA-N |
| XLogP | 1.60 |
| TPSA | 34.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|