C31H29NOP+ — CID 132577091
1-(4-hydroxy-1-imino-3-methyl-3,4-dihydro-2H-naphthalen-2-yl)ethenyl-triphenylphosphanium (PubChem CID 132577091) has the molecular formula C31H29NOP+ and a molecular weight of 462.55 g/mol. Its IUPAC name is 1-(4-hydroxy-1-imino-3-methyl-3,4-dihydro-2H-naphthalen-2-yl)ethenyl-triphenylphosphanium.
| Compound Name | 1-(4-hydroxy-1-imino-3-methyl-3,4-dihydro-2H-naphthalen-2-yl)ethenyl-triphenylphosphanium |
|---|---|
| PubChem CID | 132577091 |
| Molecular Formula | C31H29NOP+ |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | 1-(4-hydroxy-1-imino-3-methyl-3,4-dihydro-2H-naphthalen-2-yl)ethenyl-triphenylphosphanium |
| SMILES | [H]/N=C1\c2ccccc2C(O)C(C)C1C(=C)[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H29NOP/c1-22-29(30(32)27-20-12-13-21-28(27)31(22)33)23(2)34(24-14-6-3-7-15-24,25-16-8-4-9-17-25)26-18-10-5-11-19-26/h3-22,29,31-33H,2H2,1H3/q+1/b32-30+ |
| InChIKey | GASKGBYPKPAVTR-NHQGMKOOSA-N |
| XLogP | 5.86 |
| TPSA | 44.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|