C29H21F2NO — CID 155931217
(9R,10S)-10-[(E)-2-(benzhydrylideneamino)ethenyl]-3,6-difluoro-9,10-dihydrophenanthren-9-ol (PubChem CID 155931217) has the molecular formula C29H21F2NO and a molecular weight of 437.49 g/mol. Its IUPAC name is (9R,10S)-10-[(E)-2-(benzhydrylideneamino)ethenyl]-3,6-difluoro-9,10-dihydrophenanthren-9-ol.
| Compound Name | (9R,10S)-10-[(E)-2-(benzhydrylideneamino)ethenyl]-3,6-difluoro-9,10-dihydrophenanthren-9-ol |
|---|---|
| PubChem CID | 155931217 |
| Molecular Formula | C29H21F2NO |
| Molecular Weight | 437.49 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | (9R,10S)-10-[(E)-2-(benzhydrylideneamino)ethenyl]-3,6-difluoro-9,10-dihydrophenanthren-9-ol |
| SMILES | O[C@H]1c2ccc(F)cc2-c2cc(F)ccc2[C@@H]1/C=C/N=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H21F2NO/c30-21-11-13-23-25(29(33)24-14-12-22(31)18-27(24)26(23)17-21)15-16-32-28(19-7-3-1-4-8-19)20-9-5-2-6-10-20/h1-18,25,29,33H/b16-15+/t25-,29-/m0/s1 |
| InChIKey | UYWIFGVEMNMDKG-SECODISRSA-N |
| XLogP | 6.81 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.49 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|