C31H21F6NO — CID 155931213
(9R,10S)-10-[(E)-2-(benzhydrylideneamino)ethenyl]-2,7-bis(trifluoromethyl)-9,10-dihydrophenanthren-9-ol (PubChem CID 155931213) has the molecular formula C31H21F6NO and a molecular weight of 537.50 g/mol. Its IUPAC name is (9R,10S)-10-[(E)-2-(benzhydrylideneamino)ethenyl]-2,7-bis(trifluoromethyl)-9,10-dihydrophenanthren-9-ol.
| Compound Name | (9R,10S)-10-[(E)-2-(benzhydrylideneamino)ethenyl]-2,7-bis(trifluoromethyl)-9,10-dihydrophenanthren-9-ol |
|---|---|
| PubChem CID | 155931213 |
| Molecular Formula | C31H21F6NO |
| Molecular Weight | 537.50 g/mol |
| Exact Mass | 537.15 |
| IUPAC Name | (9R,10S)-10-[(E)-2-(benzhydrylideneamino)ethenyl]-2,7-bis(trifluoromethyl)-9,10-dihydrophenanthren-9-ol |
| SMILES | O[C@H]1c2cc(C(F)(F)F)ccc2-c2ccc(C(F)(F)F)cc2[C@@H]1/C=C/N=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H21F6NO/c32-30(33,34)21-11-13-23-24-14-12-22(31(35,36)37)18-27(24)29(39)25(26(23)17-21)15-16-38-28(19-7-3-1-4-8-19)20-9-5-2-6-10-20/h1-18,25,29,39H/b16-15+/t25-,29+/m0/s1 |
| InChIKey | IOOFYFDLZNQSHL-FGHWWHPSSA-N |
| XLogP | 8.57 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.50 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|