C31H24F3NO2 — CID 155931215
(9R,10S)-10-[(E)-2-(benzhydrylideneamino)ethenyl]-7-methoxy-3-(trifluoromethyl)-9,10-dihydrophenanthren-9-ol (PubChem CID 155931215) has the molecular formula C31H24F3NO2 and a molecular weight of 499.53 g/mol. Its IUPAC name is (9R,10S)-10-[(E)-2-(benzhydrylideneamino)ethenyl]-7-methoxy-3-(trifluoromethyl)-9,10-dihydrophenanthren-9-ol.
| Compound Name | (9R,10S)-10-[(E)-2-(benzhydrylideneamino)ethenyl]-7-methoxy-3-(trifluoromethyl)-9,10-dihydrophenanthren-9-ol |
|---|---|
| PubChem CID | 155931215 |
| Molecular Formula | C31H24F3NO2 |
| Molecular Weight | 499.53 g/mol |
| Exact Mass | 499.18 |
| IUPAC Name | (9R,10S)-10-[(E)-2-(benzhydrylideneamino)ethenyl]-7-methoxy-3-(trifluoromethyl)-9,10-dihydrophenanthren-9-ol |
| SMILES | COc1ccc2c(c1)[C@H](O)[C@@H](/C=C/N=C(c1ccccc1)c1ccccc1)c1ccc(C(F)(F)F)cc1-2 |
| InChI | InChI=1S/C31H24F3NO2/c1-37-23-13-15-25-27-18-22(31(32,33)34)12-14-24(27)26(30(36)28(25)19-23)16-17-35-29(20-8-4-2-5-9-20)21-10-6-3-7-11-21/h2-19,26,30,36H,1H3/b17-16+/t26-,30+/m0/s1 |
| InChIKey | PSONSIDNABRQRR-MXOCEDALSA-N |
| XLogP | 7.56 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.53 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|