C56H43NO — CID 143190445
[3-[3-[3-[(3Z)-4-(1-methyl-7-phenylnaphthalen-2-yl)buta-1,3-dien-2-yl]phenyl]phenyl]phenyl]-[(E)-(7-phenyl-2H-naphthalen-1-ylidene)amino]methanol (PubChem CID 143190445) has the molecular formula C56H43NO and a molecular weight of 745.97 g/mol. Its IUPAC name is [3-[3-[3-[(3Z)-4-(1-methyl-7-phenylnaphthalen-2-yl)buta-1,3-dien-2-yl]phenyl]phenyl]phenyl]-[(E)-(7-phenyl-2H-naphthalen-1-ylidene)amino]methanol.
| Compound Name | [3-[3-[3-[(3Z)-4-(1-methyl-7-phenylnaphthalen-2-yl)buta-1,3-dien-2-yl]phenyl]phenyl]phenyl]-[(E)-(7-phenyl-2H-naphthalen-1-ylidene)amino]methanol |
|---|---|
| PubChem CID | 143190445 |
| Molecular Formula | C56H43NO |
| Molecular Weight | 745.97 g/mol |
| Exact Mass | 745.33 |
| IUPAC Name | [3-[3-[3-[(3Z)-4-(1-methyl-7-phenylnaphthalen-2-yl)buta-1,3-dien-2-yl]phenyl]phenyl]phenyl]-[(E)-(7-phenyl-2H-naphthalen-1-ylidene)amino]methanol |
| SMILES | C=C(/C=C\c1ccc2ccc(-c3ccccc3)cc2c1C)c1cccc(-c2cccc(-c3cccc(C(O)/N=C4\CC=Cc5ccc(-c6ccccc6)cc54)c3)c2)c1 |
| InChI | InChI=1S/C56H43NO/c1-38(25-26-40-27-28-44-30-32-50(36-53(44)39(40)2)41-13-5-3-6-14-41)45-18-9-19-46(33-45)47-20-10-21-48(34-47)49-22-11-23-52(35-49)56(58)57-55-24-12-17-43-29-31-51(37-54(43)55)42-15-7-4-8-16-42/h3-23,25-37,56,58H,1,24H2,2H3/b26-25-,57-55+ |
| InChIKey | ZOBOEUQOUMIEQP-SVHVGKCMSA-N |
| XLogP | 14.44 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.97 |
| LogP ≤ 5 | 14.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|