C32H27NO — CID 164680308
2-[2-[(benzhydrylideneamino)methyl]naphthalen-1-yl]-3,5-dimethylphenol (PubChem CID 164680308) has the molecular formula C32H27NO and a molecular weight of 441.57 g/mol. Its IUPAC name is 2-[2-[(benzhydrylideneamino)methyl]naphthalen-1-yl]-3,5-dimethylphenol.
| Compound Name | 2-[2-[(benzhydrylideneamino)methyl]naphthalen-1-yl]-3,5-dimethylphenol |
|---|---|
| PubChem CID | 164680308 |
| Molecular Formula | C32H27NO |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | 2-[2-[(benzhydrylideneamino)methyl]naphthalen-1-yl]-3,5-dimethylphenol |
| SMILES | Cc1cc(C)c(-c2c(CN=C(c3ccccc3)c3ccccc3)ccc3ccccc23)c(O)c1 |
| InChI | InChI=1S/C32H27NO/c1-22-19-23(2)30(29(34)20-22)31-27(18-17-24-11-9-10-16-28(24)31)21-33-32(25-12-5-3-6-13-25)26-14-7-4-8-15-26/h3-20,34H,21H2,1-2H3 |
| InChIKey | QNPLBZOYKBNJKG-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|