C33H29NO — CID 164680305
2-[2-[(benzhydrylideneamino)methyl]-7-methylnaphthalen-1-yl]-3,5-dimethylphenol (PubChem CID 164680305) has the molecular formula C33H29NO and a molecular weight of 455.60 g/mol. Its IUPAC name is 2-[2-[(benzhydrylideneamino)methyl]-7-methylnaphthalen-1-yl]-3,5-dimethylphenol.
| Compound Name | 2-[2-[(benzhydrylideneamino)methyl]-7-methylnaphthalen-1-yl]-3,5-dimethylphenol |
|---|---|
| PubChem CID | 164680305 |
| Molecular Formula | C33H29NO |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | 2-[2-[(benzhydrylideneamino)methyl]-7-methylnaphthalen-1-yl]-3,5-dimethylphenol |
| SMILES | Cc1cc(C)c(-c2c(CN=C(c3ccccc3)c3ccccc3)ccc3ccc(C)cc23)c(O)c1 |
| InChI | InChI=1S/C33H29NO/c1-22-14-15-25-16-17-28(32(29(25)19-22)31-24(3)18-23(2)20-30(31)35)21-34-33(26-10-6-4-7-11-26)27-12-8-5-9-13-27/h4-20,35H,21H2,1-3H3 |
| InChIKey | NHTPHZZESCYQDO-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|