C31H25NO — CID 11524736
(2S)-2-(naphthalen-1-ylmethylideneamino)-1,1,2-triphenylethanol (PubChem CID 11524736) has the molecular formula C31H25NO and a molecular weight of 427.55 g/mol. Its IUPAC name is (2S)-2-(naphthalen-1-ylmethylideneamino)-1,1,2-triphenylethanol.
| Compound Name | (2S)-2-(naphthalen-1-ylmethylideneamino)-1,1,2-triphenylethanol |
|---|---|
| PubChem CID | 11524736 |
| Molecular Formula | C31H25NO |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | (2S)-2-(naphthalen-1-ylmethylideneamino)-1,1,2-triphenylethanol |
| SMILES | OC(c1ccccc1)(c1ccccc1)[C@@H](/N=C/c1cccc2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C31H25NO/c33-31(27-18-6-2-7-19-27,28-20-8-3-9-21-28)30(25-14-4-1-5-15-25)32-23-26-17-12-16-24-13-10-11-22-29(24)26/h1-23,30,33H/b32-23+/t30-/m0/s1 |
| InChIKey | DHESUXFVMRLLTC-WDTGHZBBSA-N |
| XLogP | 6.94 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|