C28H18F17NO — CID 101464203
(2S,3S)-4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoro-2-(naphthalen-2-ylmethylideneamino)-1-phenylundecan-3-ol (PubChem CID 101464203) has the molecular formula C28H18F17NO and a molecular weight of 707.42 g/mol. Its IUPAC name is (2S,3S)-4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoro-2-(naphthalen-2-ylmethylideneamino)-1-phenylundecan-3-ol.
| Compound Name | (2S,3S)-4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoro-2-(naphthalen-2-ylmethylideneamino)-1-phenylundecan-3-ol |
|---|---|
| PubChem CID | 101464203 |
| Molecular Formula | C28H18F17NO |
| Molecular Weight | 707.42 g/mol |
| Exact Mass | 707.11 |
| IUPAC Name | (2S,3S)-4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoro-2-(naphthalen-2-ylmethylideneamino)-1-phenylundecan-3-ol |
| SMILES | O[C@@H]([C@H](Cc1ccccc1)/N=C/c1ccc2ccccc2c1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C28H18F17NO/c29-21(30,22(31,32)23(33,34)24(35,36)25(37,38)26(39,40)27(41,42)28(43,44)45)20(47)19(13-15-6-2-1-3-7-15)46-14-16-10-11-17-8-4-5-9-18(17)12-16/h1-12,14,19-20,47H,13H2/b46-14+/t19-,20-/m0/s1 |
| InChIKey | HCFDAPCUCBRVCG-YTYYPMRHSA-N |
| XLogP | 9.24 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.42 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|