C24H16F17NO — CID 101456316
(2S,3S)-2-(benzylideneamino)-4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoro-1-phenylundecan-3-ol (PubChem CID 101456316) has the molecular formula C24H16F17NO and a molecular weight of 657.36 g/mol. Its IUPAC name is (2S,3S)-2-(benzylideneamino)-4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoro-1-phenylundecan-3-ol.
| Compound Name | (2S,3S)-2-(benzylideneamino)-4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoro-1-phenylundecan-3-ol |
|---|---|
| PubChem CID | 101456316 |
| Molecular Formula | C24H16F17NO |
| Molecular Weight | 657.36 g/mol |
| Exact Mass | 657.10 |
| IUPAC Name | (2S,3S)-2-(benzylideneamino)-4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoro-1-phenylundecan-3-ol |
| SMILES | O[C@@H]([C@H](Cc1ccccc1)/N=C/c1ccccc1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C24H16F17NO/c25-17(26,16(43)15(11-13-7-3-1-4-8-13)42-12-14-9-5-2-6-10-14)18(27,28)19(29,30)20(31,32)21(33,34)22(35,36)23(37,38)24(39,40)41/h1-10,12,15-16,43H,11H2/b42-12+/t15-,16-/m0/s1 |
| InChIKey | OIOFFESAIYYZQD-RTCOHXDASA-N |
| XLogP | 8.09 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.36 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|