C17H18FN3O — CID 22910080
2-azido-4-fluoro-1,5-diphenylpentan-3-ol (PubChem CID 22910080) has the molecular formula C17H18FN3O and a molecular weight of 299.35 g/mol. Its IUPAC name is 2-azido-4-fluoro-1,5-diphenylpentan-3-ol.
| Compound Name | 2-azido-4-fluoro-1,5-diphenylpentan-3-ol |
|---|---|
| PubChem CID | 22910080 |
| Molecular Formula | C17H18FN3O |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 2-azido-4-fluoro-1,5-diphenylpentan-3-ol |
| SMILES | [N-]=[N+]=NC(Cc1ccccc1)C(O)C(F)Cc1ccccc1 |
| InChI | InChI=1S/C17H18FN3O/c18-15(11-13-7-3-1-4-8-13)17(22)16(20-21-19)12-14-9-5-2-6-10-14/h1-10,15-17,22H,11-12H2 |
| InChIKey | DQPXDKVJZKFFKJ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 68.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|