C17H14FN3O — CID 102523597
(1R,5R)-5-azido-2-(4-fluorophenyl)-3-phenylcyclopent-2-en-1-ol (PubChem CID 102523597) has the molecular formula C17H14FN3O and a molecular weight of 295.32 g/mol. Its IUPAC name is (1R,5R)-5-azido-2-(4-fluorophenyl)-3-phenylcyclopent-2-en-1-ol.
| Compound Name | (1R,5R)-5-azido-2-(4-fluorophenyl)-3-phenylcyclopent-2-en-1-ol |
|---|---|
| PubChem CID | 102523597 |
| Molecular Formula | C17H14FN3O |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | (1R,5R)-5-azido-2-(4-fluorophenyl)-3-phenylcyclopent-2-en-1-ol |
| SMILES | [N-]=[N+]=N[C@@H]1CC(c2ccccc2)=C(c2ccc(F)cc2)[C@H]1O |
| InChI | InChI=1S/C17H14FN3O/c18-13-8-6-12(7-9-13)16-14(11-4-2-1-3-5-11)10-15(17(16)22)20-21-19/h1-9,15,17,22H,10H2/t15-,17+/m1/s1 |
| InChIKey | JKSDYVROIWYQFH-WBVHZDCISA-N |
| XLogP | 4.18 |
| TPSA | 68.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|