C20H16F9NO — CID 101456319
(2S,3S)-2-(benzylideneamino)-4,4,5,5,6,6,7,7,7-nonafluoro-1-phenylheptan-3-ol (PubChem CID 101456319) has the molecular formula C20H16F9NO and a molecular weight of 457.34 g/mol. Its IUPAC name is (2S,3S)-2-(benzylideneamino)-4,4,5,5,6,6,7,7,7-nonafluoro-1-phenylheptan-3-ol.
| Compound Name | (2S,3S)-2-(benzylideneamino)-4,4,5,5,6,6,7,7,7-nonafluoro-1-phenylheptan-3-ol |
|---|---|
| PubChem CID | 101456319 |
| Molecular Formula | C20H16F9NO |
| Molecular Weight | 457.34 g/mol |
| Exact Mass | 457.11 |
| IUPAC Name | (2S,3S)-2-(benzylideneamino)-4,4,5,5,6,6,7,7,7-nonafluoro-1-phenylheptan-3-ol |
| SMILES | O[C@@H]([C@H](Cc1ccccc1)/N=C/c1ccccc1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C20H16F9NO/c21-17(22,18(23,24)19(25,26)20(27,28)29)16(31)15(11-13-7-3-1-4-8-13)30-12-14-9-5-2-6-10-14/h1-10,12,15-16,31H,11H2/b30-12+/t15-,16-/m0/s1 |
| InChIKey | GYLRXLWBSSWRQO-AVGKEJFHSA-N |
| XLogP | 5.55 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.34 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|