C24H18F9NO — CID 101456321
(2S,3S)-4,4,5,5,6,6,7,7,7-nonafluoro-2-(naphthalen-1-ylmethylideneamino)-1-phenylheptan-3-ol (PubChem CID 101456321) has the molecular formula C24H18F9NO and a molecular weight of 507.40 g/mol. Its IUPAC name is (2S,3S)-4,4,5,5,6,6,7,7,7-nonafluoro-2-(naphthalen-1-ylmethylideneamino)-1-phenylheptan-3-ol.
| Compound Name | (2S,3S)-4,4,5,5,6,6,7,7,7-nonafluoro-2-(naphthalen-1-ylmethylideneamino)-1-phenylheptan-3-ol |
|---|---|
| PubChem CID | 101456321 |
| Molecular Formula | C24H18F9NO |
| Molecular Weight | 507.40 g/mol |
| Exact Mass | 507.12 |
| IUPAC Name | (2S,3S)-4,4,5,5,6,6,7,7,7-nonafluoro-2-(naphthalen-1-ylmethylideneamino)-1-phenylheptan-3-ol |
| SMILES | O[C@@H]([C@H](Cc1ccccc1)/N=C/c1cccc2ccccc12)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C24H18F9NO/c25-21(26,22(27,28)23(29,30)24(31,32)33)20(35)19(13-15-7-2-1-3-8-15)34-14-17-11-6-10-16-9-4-5-12-18(16)17/h1-12,14,19-20,35H,13H2/b34-14+/t19-,20-/m0/s1 |
| InChIKey | PPGHZSMURAUTJE-CFMUQIHCSA-N |
| XLogP | 6.70 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.40 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|