C23H19F3O4S — CID 135055710
[(E)-3,3,3-trifluoro-1-(4-methoxyphenyl)-1-phenylprop-1-en-2-yl] 4-methylbenzenesulfonate (PubChem CID 135055710) has the molecular formula C23H19F3O4S and a molecular weight of 448.46 g/mol. Its IUPAC name is [(E)-3,3,3-trifluoro-1-(4-methoxyphenyl)-1-phenylprop-1-en-2-yl] 4-methylbenzenesulfonate.
| Compound Name | [(E)-3,3,3-trifluoro-1-(4-methoxyphenyl)-1-phenylprop-1-en-2-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 135055710 |
| Molecular Formula | C23H19F3O4S |
| Molecular Weight | 448.46 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | [(E)-3,3,3-trifluoro-1-(4-methoxyphenyl)-1-phenylprop-1-en-2-yl] 4-methylbenzenesulfonate |
| SMILES | COc1ccc(/C(=C(/OS(=O)(=O)c2ccc(C)cc2)C(F)(F)F)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H19F3O4S/c1-16-8-14-20(15-9-16)31(27,28)30-22(23(24,25)26)21(17-6-4-3-5-7-17)18-10-12-19(29-2)13-11-18/h3-15H,1-2H3/b22-21+ |
| InChIKey | AZJZRMSSUREIDZ-QURGRASLSA-N |
| XLogP | 5.73 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.46 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|