C18H26O5 — CID 135056145
dimethyl (3aS,5E,8Z,9aR)-6-(methoxymethyl)-8-methyl-1,3,3a,4,7,9a-hexahydrocyclopenta[8]annulene-2,2-dicarboxylate (PubChem CID 135056145) has the molecular formula C18H26O5 and a molecular weight of 322.40 g/mol. Its IUPAC name is dimethyl (3aS,5E,8Z,9aR)-6-(methoxymethyl)-8-methyl-1,3,3a,4,7,9a-hexahydrocyclopenta[8]annulene-2,2-dicarboxylate.
| Compound Name | dimethyl (3aS,5E,8Z,9aR)-6-(methoxymethyl)-8-methyl-1,3,3a,4,7,9a-hexahydrocyclopenta[8]annulene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 135056145 |
| Molecular Formula | C18H26O5 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | dimethyl (3aS,5E,8Z,9aR)-6-(methoxymethyl)-8-methyl-1,3,3a,4,7,9a-hexahydrocyclopenta[8]annulene-2,2-dicarboxylate |
| SMILES | COC/C1=C/C[C@H]2CC(C(=O)OC)(C(=O)OC)C[C@H]2/C=C(/C)C1 |
| InChI | InChI=1S/C18H26O5/c1-12-7-13(11-21-2)5-6-14-9-18(16(19)22-3,17(20)23-4)10-15(14)8-12/h5,8,14-15H,6-7,9-11H2,1-4H3/b12-8-,13-5+/t14-,15+/m0/s1 |
| InChIKey | NDJCYXRXCFJKRN-VVYVVCHNSA-N |
| XLogP | 2.66 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|