C11H18O2 — CID 135057221
(4Z)-3-[(E)-but-1-enyl]-4-(ethoxymethylidene)oxolane (PubChem CID 135057221) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is (4Z)-3-[(E)-but-1-enyl]-4-(ethoxymethylidene)oxolane.
| Compound Name | (4Z)-3-[(E)-but-1-enyl]-4-(ethoxymethylidene)oxolane |
|---|---|
| PubChem CID | 135057221 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | (4Z)-3-[(E)-but-1-enyl]-4-(ethoxymethylidene)oxolane |
| SMILES | CC/C=C/C1COC/C1=C\OCC |
| InChI | InChI=1S/C11H18O2/c1-3-5-6-10-7-13-9-11(10)8-12-4-2/h5-6,8,10H,3-4,7,9H2,1-2H3/b6-5+,11-8+ |
| InChIKey | RNLSMTPQENTNBO-BXROQLSZSA-N |
| XLogP | 2.52 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|