C13H18O — CID 123568848
5-hepta-1,3,5-trien-2-yl-2,3-dimethyl-2,3-dihydrofuran (PubChem CID 123568848) has the molecular formula C13H18O and a molecular weight of 190.29 g/mol. Its IUPAC name is 5-hepta-1,3,5-trien-2-yl-2,3-dimethyl-2,3-dihydrofuran.
| Compound Name | 5-hepta-1,3,5-trien-2-yl-2,3-dimethyl-2,3-dihydrofuran |
|---|---|
| PubChem CID | 123568848 |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | 5-hepta-1,3,5-trien-2-yl-2,3-dimethyl-2,3-dihydrofuran |
| SMILES | C=C(C=CC=CC)C1=CC(C)C(C)O1 |
| InChI | InChI=1S/C13H18O/c1-5-6-7-8-10(2)13-9-11(3)12(4)14-13/h5-9,11-12H,2H2,1,3-4H3 |
| InChIKey | IHFOIQLEVRVQSC-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|