C9H10O3 — CID 135057281
(6aR)-3-ethenoxy-1,3,6,6a-tetrahydrocyclopenta[c]furan-5-one (PubChem CID 135057281) has the molecular formula C9H10O3 and a molecular weight of 166.18 g/mol. Its IUPAC name is (6aR)-3-ethenoxy-1,3,6,6a-tetrahydrocyclopenta[c]furan-5-one.
| Compound Name | (6aR)-3-ethenoxy-1,3,6,6a-tetrahydrocyclopenta[c]furan-5-one |
|---|---|
| PubChem CID | 135057281 |
| Molecular Formula | C9H10O3 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | (6aR)-3-ethenoxy-1,3,6,6a-tetrahydrocyclopenta[c]furan-5-one |
| SMILES | C=COC1OC[C@@H]2CC(=O)C=C12 |
| InChI | InChI=1S/C9H10O3/c1-2-11-9-8-4-7(10)3-6(8)5-12-9/h2,4,6,9H,1,3,5H2/t6-,9?/m0/s1 |
| InChIKey | YLXOPTCHMSRKTD-AADKRJSRSA-N |
| XLogP | 1.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|