C28H38O — CID 135059026
2,3-bis(4-tert-butylcyclohexen-1-yl)-1-benzofuran (PubChem CID 135059026) has the molecular formula C28H38O and a molecular weight of 390.61 g/mol. Its IUPAC name is 2,3-bis(4-tert-butylcyclohexen-1-yl)-1-benzofuran.
| Compound Name | 2,3-bis(4-tert-butylcyclohexen-1-yl)-1-benzofuran |
|---|---|
| PubChem CID | 135059026 |
| Molecular Formula | C28H38O |
| Molecular Weight | 390.61 g/mol |
| Exact Mass | 390.29 |
| IUPAC Name | 2,3-bis(4-tert-butylcyclohexen-1-yl)-1-benzofuran |
| SMILES | CC(C)(C)C1CC=C(c2oc3ccccc3c2C2=CCC(C(C)(C)C)CC2)CC1 |
| InChI | InChI=1S/C28H38O/c1-27(2,3)21-15-11-19(12-16-21)25-23-9-7-8-10-24(23)29-26(25)20-13-17-22(18-14-20)28(4,5)6/h7-11,13,21-22H,12,14-18H2,1-6H3 |
| InChIKey | PTBQFXZGVZLZQO-UHFFFAOYSA-N |
| XLogP | 8.89 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.61 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |