C18H26 — CID 90705107
1-(4-tert-butylcyclohexen-1-yl)-4-ethylbenzene (PubChem CID 90705107) has the molecular formula C18H26 and a molecular weight of 242.41 g/mol. Its IUPAC name is 1-(4-tert-butylcyclohexen-1-yl)-4-ethylbenzene.
| Compound Name | 1-(4-tert-butylcyclohexen-1-yl)-4-ethylbenzene |
|---|---|
| PubChem CID | 90705107 |
| Molecular Formula | C18H26 |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | 1-(4-tert-butylcyclohexen-1-yl)-4-ethylbenzene |
| SMILES | CCc1ccc(C2=CCC(C(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C18H26/c1-5-14-6-8-15(9-7-14)16-10-12-17(13-11-16)18(2,3)4/h6-10,17H,5,11-13H2,1-4H3 |
| InChIKey | DCCJMRYVFJWFBZ-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |