C27H36O2 — CID 139944963
4-[4-[2-(4-hydroxyphenyl)nonan-2-yl]cyclohexen-1-yl]phenol (PubChem CID 139944963) has the molecular formula C27H36O2 and a molecular weight of 392.58 g/mol. Its IUPAC name is 4-[4-[2-(4-hydroxyphenyl)nonan-2-yl]cyclohexen-1-yl]phenol.
| Compound Name | 4-[4-[2-(4-hydroxyphenyl)nonan-2-yl]cyclohexen-1-yl]phenol |
|---|---|
| PubChem CID | 139944963 |
| Molecular Formula | C27H36O2 |
| Molecular Weight | 392.58 g/mol |
| Exact Mass | 392.27 |
| IUPAC Name | 4-[4-[2-(4-hydroxyphenyl)nonan-2-yl]cyclohexen-1-yl]phenol |
| SMILES | CCCCCCCC(C)(c1ccc(O)cc1)C1CC=C(c2ccc(O)cc2)CC1 |
| InChI | InChI=1S/C27H36O2/c1-3-4-5-6-7-20-27(2,24-14-18-26(29)19-15-24)23-12-8-21(9-13-23)22-10-16-25(28)17-11-22/h8,10-11,14-19,23,28-29H,3-7,9,12-13,20H2,1-2H3 |
| InChIKey | QKZWXPHPQGZNPS-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.58 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|