C25H32O2 — CID 139945026
4-[4-[2-(4-hydroxyphenyl)-4-methylhexan-2-yl]cyclohexen-1-yl]phenol (PubChem CID 139945026) has the molecular formula C25H32O2 and a molecular weight of 364.53 g/mol. Its IUPAC name is 4-[4-[2-(4-hydroxyphenyl)-4-methylhexan-2-yl]cyclohexen-1-yl]phenol.
| Compound Name | 4-[4-[2-(4-hydroxyphenyl)-4-methylhexan-2-yl]cyclohexen-1-yl]phenol |
|---|---|
| PubChem CID | 139945026 |
| Molecular Formula | C25H32O2 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | 4-[4-[2-(4-hydroxyphenyl)-4-methylhexan-2-yl]cyclohexen-1-yl]phenol |
| SMILES | CCC(C)CC(C)(c1ccc(O)cc1)C1CC=C(c2ccc(O)cc2)CC1 |
| InChI | InChI=1S/C25H32O2/c1-4-18(2)17-25(3,22-11-15-24(27)16-12-22)21-9-5-19(6-10-21)20-7-13-23(26)14-8-20/h5,7-8,11-16,18,21,26-27H,4,6,9-10,17H2,1-3H3 |
| InChIKey | UBTLFSSEBNTELG-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |