C18H26INO — CID 135059267
2-[3-ethyl-3-(2-iodophenyl)pentyl]-4,4-dimethyl-5H-1,3-oxazole (PubChem CID 135059267) has the molecular formula C18H26INO and a molecular weight of 399.32 g/mol. Its IUPAC name is 2-[3-ethyl-3-(2-iodophenyl)pentyl]-4,4-dimethyl-5H-1,3-oxazole.
| Compound Name | 2-[3-ethyl-3-(2-iodophenyl)pentyl]-4,4-dimethyl-5H-1,3-oxazole |
|---|---|
| PubChem CID | 135059267 |
| Molecular Formula | C18H26INO |
| Molecular Weight | 399.32 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | 2-[3-ethyl-3-(2-iodophenyl)pentyl]-4,4-dimethyl-5H-1,3-oxazole |
| SMILES | CCC(CC)(CCC1=NC(C)(C)CO1)c1ccccc1I |
| InChI | InChI=1S/C18H26INO/c1-5-18(6-2,14-9-7-8-10-15(14)19)12-11-16-20-17(3,4)13-21-16/h7-10H,5-6,11-13H2,1-4H3 |
| InChIKey | OCBINLRMLBILLI-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.32 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|