C25H36FNO — CID 143349374
4-[2-[4-[(Z,5Z)-5-ethylidenenon-6-enyl]phenyl]ethyl]-4-(2-fluoroethyl)-2-methyl-5H-1,3-oxazole (PubChem CID 143349374) has the molecular formula C25H36FNO and a molecular weight of 385.57 g/mol. Its IUPAC name is 4-[2-[4-[(Z,5Z)-5-ethylidenenon-6-enyl]phenyl]ethyl]-4-(2-fluoroethyl)-2-methyl-5H-1,3-oxazole.
| Compound Name | 4-[2-[4-[(Z,5Z)-5-ethylidenenon-6-enyl]phenyl]ethyl]-4-(2-fluoroethyl)-2-methyl-5H-1,3-oxazole |
|---|---|
| PubChem CID | 143349374 |
| Molecular Formula | C25H36FNO |
| Molecular Weight | 385.57 g/mol |
| Exact Mass | 385.28 |
| IUPAC Name | 4-[2-[4-[(Z,5Z)-5-ethylidenenon-6-enyl]phenyl]ethyl]-4-(2-fluoroethyl)-2-methyl-5H-1,3-oxazole |
| SMILES | C/C=C(\C=C/CC)CCCCc1ccc(CCC2(CCF)COC(C)=N2)cc1 |
| InChI | InChI=1S/C25H36FNO/c1-4-6-9-22(5-2)10-7-8-11-23-12-14-24(15-13-23)16-17-25(18-19-26)20-28-21(3)27-25/h5-6,9,12-15H,4,7-8,10-11,16-20H2,1-3H3/b9-6-,22-5+ |
| InChIKey | HQRZFQXKBOJEHM-QKNRFVDZSA-N |
| XLogP | 6.79 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.57 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|