C31H45FNO4P — CID 143349420
ditert-butyl [4-[2-[2-fluoro-4-(4-phenylbutyl)phenyl]ethyl]-2-methyl-5H-1,3-oxazol-4-yl]methyl phosphite (PubChem CID 143349420) has the molecular formula C31H45FNO4P and a molecular weight of 545.68 g/mol. Its IUPAC name is ditert-butyl [4-[2-[2-fluoro-4-(4-phenylbutyl)phenyl]ethyl]-2-methyl-5H-1,3-oxazol-4-yl]methyl phosphite.
| Compound Name | ditert-butyl [4-[2-[2-fluoro-4-(4-phenylbutyl)phenyl]ethyl]-2-methyl-5H-1,3-oxazol-4-yl]methyl phosphite |
|---|---|
| PubChem CID | 143349420 |
| Molecular Formula | C31H45FNO4P |
| Molecular Weight | 545.68 g/mol |
| Exact Mass | 545.31 |
| IUPAC Name | ditert-butyl [4-[2-[2-fluoro-4-(4-phenylbutyl)phenyl]ethyl]-2-methyl-5H-1,3-oxazol-4-yl]methyl phosphite |
| SMILES | CC1=NC(CCc2ccc(CCCCc3ccccc3)cc2F)(COP(OC(C)(C)C)OC(C)(C)C)CO1 |
| InChI | InChI=1S/C31H45FNO4P/c1-24-33-31(22-34-24,23-35-38(36-29(2,3)4)37-30(5,6)7)20-19-27-18-17-26(21-28(27)32)16-12-11-15-25-13-9-8-10-14-25/h8-10,13-14,17-18,21H,11-12,15-16,19-20,22-23H2,1-7H3 |
| InChIKey | GIWKLPUYMCLWDC-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 49.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.68 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|