C32H45F3NO5P — CID 143349359
ditert-butyl [2-methyl-4-[2-[4-[4-[4-(trifluoromethyl)phenyl]butyl]phenyl]ethyl]-5H-1,3-oxazol-4-yl]methyl phosphate (PubChem CID 143349359) has the molecular formula C32H45F3NO5P and a molecular weight of 611.68 g/mol. Its IUPAC name is ditert-butyl [2-methyl-4-[2-[4-[4-[4-(trifluoromethyl)phenyl]butyl]phenyl]ethyl]-5H-1,3-oxazol-4-yl]methyl phosphate.
| Compound Name | ditert-butyl [2-methyl-4-[2-[4-[4-[4-(trifluoromethyl)phenyl]butyl]phenyl]ethyl]-5H-1,3-oxazol-4-yl]methyl phosphate |
|---|---|
| PubChem CID | 143349359 |
| Molecular Formula | C32H45F3NO5P |
| Molecular Weight | 611.68 g/mol |
| Exact Mass | 611.30 |
| IUPAC Name | ditert-butyl [2-methyl-4-[2-[4-[4-[4-(trifluoromethyl)phenyl]butyl]phenyl]ethyl]-5H-1,3-oxazol-4-yl]methyl phosphate |
| SMILES | CC1=NC(CCc2ccc(CCCCc3ccc(C(F)(F)F)cc3)cc2)(COP(=O)(OC(C)(C)C)OC(C)(C)C)CO1 |
| InChI | InChI=1S/C32H45F3NO5P/c1-24-36-31(22-38-24,23-39-42(37,40-29(2,3)4)41-30(5,6)7)21-20-27-14-12-25(13-15-27)10-8-9-11-26-16-18-28(19-17-26)32(33,34)35/h12-19H,8-11,20-23H2,1-7H3 |
| InChIKey | ZNBHZFKYPTZZRT-UHFFFAOYSA-N |
| XLogP | 9.15 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.68 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|