C35H54NO5P — CID 91034077
ditert-butyl [2-methyl-4-[2-[4-(4-octylphenyl)phenyl]ethyl]-5H-1,3-oxazol-4-yl]methyl phosphate (PubChem CID 91034077) has the molecular formula C35H54NO5P and a molecular weight of 599.79 g/mol. Its IUPAC name is ditert-butyl [2-methyl-4-[2-[4-(4-octylphenyl)phenyl]ethyl]-5H-1,3-oxazol-4-yl]methyl phosphate.
| Compound Name | ditert-butyl [2-methyl-4-[2-[4-(4-octylphenyl)phenyl]ethyl]-5H-1,3-oxazol-4-yl]methyl phosphate |
|---|---|
| PubChem CID | 91034077 |
| Molecular Formula | C35H54NO5P |
| Molecular Weight | 599.79 g/mol |
| Exact Mass | 599.37 |
| IUPAC Name | ditert-butyl [2-methyl-4-[2-[4-(4-octylphenyl)phenyl]ethyl]-5H-1,3-oxazol-4-yl]methyl phosphate |
| SMILES | CCCCCCCCc1ccc(-c2ccc(CCC3(COP(=O)(OC(C)(C)C)OC(C)(C)C)COC(C)=N3)cc2)cc1 |
| InChI | InChI=1S/C35H54NO5P/c1-9-10-11-12-13-14-15-29-16-20-31(21-17-29)32-22-18-30(19-23-32)24-25-35(26-38-28(2)36-35)27-39-42(37,40-33(3,4)5)41-34(6,7)8/h16-23H,9-15,24-27H2,1-8H3 |
| InChIKey | KAWPMVFRWRSPMT-UHFFFAOYSA-N |
| XLogP | 10.13 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.79 |
| LogP ≤ 5 | 10.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|