C40H35IN2O4 — CID 135060338
dibenzyl 2-(cyclohexen-1-yl)-3-iodo-4-(4-methylphenyl)-4H-pyrido[2,3-b]indole-1,9-dicarboxylate (PubChem CID 135060338) has the molecular formula C40H35IN2O4 and a molecular weight of 734.63 g/mol. Its IUPAC name is dibenzyl 2-(cyclohexen-1-yl)-3-iodo-4-(4-methylphenyl)-4H-pyrido[2,3-b]indole-1,9-dicarboxylate.
| Compound Name | dibenzyl 2-(cyclohexen-1-yl)-3-iodo-4-(4-methylphenyl)-4H-pyrido[2,3-b]indole-1,9-dicarboxylate |
|---|---|
| PubChem CID | 135060338 |
| Molecular Formula | C40H35IN2O4 |
| Molecular Weight | 734.63 g/mol |
| Exact Mass | 734.16 |
| IUPAC Name | dibenzyl 2-(cyclohexen-1-yl)-3-iodo-4-(4-methylphenyl)-4H-pyrido[2,3-b]indole-1,9-dicarboxylate |
| SMILES | Cc1ccc(C2C(I)=C(C3=CCCCC3)N(C(=O)OCc3ccccc3)c3c2c2ccccc2n3C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C40H35IN2O4/c1-27-21-23-30(24-22-27)34-35-32-19-11-12-20-33(32)42(39(44)46-25-28-13-5-2-6-14-28)38(35)43(37(36(34)41)31-17-9-4-10-18-31)40(45)47-26-29-15-7-3-8-16-29/h2-3,5-8,11-17,19-24,34H,4,9-10,18,25-26H2,1H3 |
| InChIKey | BCPXRWBSUADJHN-UHFFFAOYSA-N |
| XLogP | 10.57 |
| TPSA | 60.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.63 |
| LogP ≤ 5 | 10.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|