C36H31IN2O2 — CID 135060341
benzyl 2-(4-tert-butylphenyl)-3-iodo-4-(4-methylphenyl)pyrido[2,3-b]indole-9-carboxylate (PubChem CID 135060341) has the molecular formula C36H31IN2O2 and a molecular weight of 650.56 g/mol. Its IUPAC name is benzyl 2-(4-tert-butylphenyl)-3-iodo-4-(4-methylphenyl)pyrido[2,3-b]indole-9-carboxylate.
| Compound Name | benzyl 2-(4-tert-butylphenyl)-3-iodo-4-(4-methylphenyl)pyrido[2,3-b]indole-9-carboxylate |
|---|---|
| PubChem CID | 135060341 |
| Molecular Formula | C36H31IN2O2 |
| Molecular Weight | 650.56 g/mol |
| Exact Mass | 650.14 |
| IUPAC Name | benzyl 2-(4-tert-butylphenyl)-3-iodo-4-(4-methylphenyl)pyrido[2,3-b]indole-9-carboxylate |
| SMILES | Cc1ccc(-c2c(I)c(-c3ccc(C(C)(C)C)cc3)nc3c2c2ccccc2n3C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C36H31IN2O2/c1-23-14-16-25(17-15-23)30-31-28-12-8-9-13-29(28)39(35(40)41-22-24-10-6-5-7-11-24)34(31)38-33(32(30)37)26-18-20-27(21-19-26)36(2,3)4/h5-21H,22H2,1-4H3 |
| InChIKey | SUABRCGONSRIJS-UHFFFAOYSA-N |
| XLogP | 9.92 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.56 |
| LogP ≤ 5 | 9.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|