C18H27NO2 — CID 135061352
(1S,5S)-2-tert-butyl-6-ethenyl-7-hexyl-2-azabicyclo[3.2.0]hept-6-ene-3,4-dione (PubChem CID 135061352) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is (1S,5S)-2-tert-butyl-6-ethenyl-7-hexyl-2-azabicyclo[3.2.0]hept-6-ene-3,4-dione.
| Compound Name | (1S,5S)-2-tert-butyl-6-ethenyl-7-hexyl-2-azabicyclo[3.2.0]hept-6-ene-3,4-dione |
|---|---|
| PubChem CID | 135061352 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | (1S,5S)-2-tert-butyl-6-ethenyl-7-hexyl-2-azabicyclo[3.2.0]hept-6-ene-3,4-dione |
| SMILES | C=CC1=C(CCCCCC)[C@@H]2[C@H]1C(=O)C(=O)N2C(C)(C)C |
| InChI | InChI=1S/C18H27NO2/c1-6-8-9-10-11-13-12(7-2)14-15(13)19(18(3,4)5)17(21)16(14)20/h7,14-15H,2,6,8-11H2,1,3-5H3/t14-,15+/m0/s1 |
| InChIKey | VLEWMHICMYRAFS-LSDHHAIUSA-N |
| XLogP | 3.65 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|