C20H33NO3 — CID 90912390
(5S)-3-acetyl-1-(3,7-dimethyloct-6-enyl)-5-(2-methylpropyl)pyrrolidine-2,4-dione (PubChem CID 90912390) has the molecular formula C20H33NO3 and a molecular weight of 335.49 g/mol. Its IUPAC name is (5S)-3-acetyl-1-(3,7-dimethyloct-6-enyl)-5-(2-methylpropyl)pyrrolidine-2,4-dione.
| Compound Name | (5S)-3-acetyl-1-(3,7-dimethyloct-6-enyl)-5-(2-methylpropyl)pyrrolidine-2,4-dione |
|---|---|
| PubChem CID | 90912390 |
| Molecular Formula | C20H33NO3 |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.25 |
| IUPAC Name | (5S)-3-acetyl-1-(3,7-dimethyloct-6-enyl)-5-(2-methylpropyl)pyrrolidine-2,4-dione |
| SMILES | CC(=O)C1C(=O)[C@H](CC(C)C)N(CCC(C)CCC=C(C)C)C1=O |
| InChI | InChI=1S/C20H33NO3/c1-13(2)8-7-9-15(5)10-11-21-17(12-14(3)4)19(23)18(16(6)22)20(21)24/h8,14-15,17-18H,7,9-12H2,1-6H3/t15?,17-,18?/m0/s1 |
| InChIKey | QINLUCXLDBIVNZ-NXYGQSRBSA-N |
| XLogP | 3.79 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|