About 5-[(E)-4,4-difluoro-3-methyldec-1-enyl]-1-(7-oxooctyl)pyrrolidin-2-one
5-[(E)-4,4-difluoro-3-methyldec-1-enyl]-1-(7-oxooctyl)pyrrolidin-2-one (PubChem CID 154515612) has the molecular formula C23H39F2NO2
and a molecular weight of 399.57 g/mol. Its IUPAC name is 5-[(E)-4,4-difluoro-3-methyldec-1-enyl]-1-(7-oxooctyl)pyrrolidin-2-one.
Molecular Properties
| Compound Name | 5-[(E)-4,4-difluoro-3-methyldec-1-enyl]-1-(7-oxooctyl)pyrrolidin-2-one |
| PubChem CID | 154515612 |
| Molecular Formula | C23H39F2NO2 |
| Molecular Weight | 399.57 g/mol |
| Exact Mass | 399.29 |
| IUPAC Name | 5-[(E)-4,4-difluoro-3-methyldec-1-enyl]-1-(7-oxooctyl)pyrrolidin-2-one |
| SMILES | CCCCCCC(F)(F)C(C)/C=C/C1CCC(=O)N1CCCCCCC(C)=O |
| InChI | InChI=1S/C23H39F2NO2/c1-4-5-6-10-17-23(24,25)19(2)13-14-21-15-16-22(28)26(21)18-11-8-7-9-12-20(3)27/h13-14,19,21H,4-12,15-18H2,1-3H3/b14-13+ |
| InChIKey | CRVRXXNZGFQHJI-BUHFOSPRSA-N |
| XLogP | 6.31 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 399.57 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-[(E)-4,4-difluoro-3-methyldec-1-enyl]-1-(7-oxooctyl)pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(E)-4,4-difluoro-3-methyldec-1-enyl]-1-(7-oxooctyl)pyrrolidin-2-one?
The IUPAC name of 5-[(E)-4,4-difluoro-3-methyldec-1-enyl]-1-(7-oxooctyl)pyrrolidin-2-one (CID 154515612) is 5-[(E)-4,4-difluoro-3-methyldec-1-enyl]-1-(7-oxooctyl)pyrrolidin-2-one.
What is the SMILES notation for 5-[(E)-4,4-difluoro-3-methyldec-1-enyl]-1-(7-oxooctyl)pyrrolidin-2-one?
The canonical SMILES for 5-[(E)-4,4-difluoro-3-methyldec-1-enyl]-1-(7-oxooctyl)pyrrolidin-2-one is CCCCCCC(F)(F)C(C)/C=C/C1CCC(=O)N1CCCCCCC(C)=O.
What is the InChIKey of 5-[(E)-4,4-difluoro-3-methyldec-1-enyl]-1-(7-oxooctyl)pyrrolidin-2-one?
The InChIKey is CRVRXXNZGFQHJI-BUHFOSPRSA-N. The full InChI is InChI=1S/C23H39F2NO2/c1-4-5-6-10-17-23(24,25)19(2)13-14-21-15-16-22(28)26(21)18-11-8-7-9-12-20(3)27/h13-14,19,21H,4-12,15-18H2,1-3H3/b14-13+.
What are the key properties of 5-[(E)-4,4-difluoro-3-methyldec-1-enyl]-1-(7-oxooctyl)pyrrolidin-2-one?
5-[(E)-4,4-difluoro-3-methyldec-1-enyl]-1-(7-oxooctyl)pyrrolidin-2-one has a molecular weight of 399.57 g/mol, XLogP of 6.31, 15 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(E)-4,4-difluoro-3-methyldec-1-enyl]-1-(7-oxooctyl)pyrrolidin-2-one is sourced from PubChem (CID 154515612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).