C15H19NO3 — CID 91569698
(5S)-3-acetyl-5-(cyclohexa-1,5-dien-1-ylmethyl)-1-ethylpyrrolidine-2,4-dione (PubChem CID 91569698) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is (5S)-3-acetyl-5-(cyclohexa-1,5-dien-1-ylmethyl)-1-ethylpyrrolidine-2,4-dione.
| Compound Name | (5S)-3-acetyl-5-(cyclohexa-1,5-dien-1-ylmethyl)-1-ethylpyrrolidine-2,4-dione |
|---|---|
| PubChem CID | 91569698 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | (5S)-3-acetyl-5-(cyclohexa-1,5-dien-1-ylmethyl)-1-ethylpyrrolidine-2,4-dione |
| SMILES | CCN1C(=O)C(C(C)=O)C(=O)[C@@H]1CC1=CCCC=C1 |
| InChI | InChI=1S/C15H19NO3/c1-3-16-12(9-11-7-5-4-6-8-11)14(18)13(10(2)17)15(16)19/h5,7-8,12-13H,3-4,6,9H2,1-2H3/t12-,13?/m0/s1 |
| InChIKey | NLBRFQDIFWXCHT-UEWDXFNNSA-N |
| XLogP | 1.66 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|