C14H10I2N2O — CID 135062928
2,3-diiodo-5-phenylmethoxy-1H-pyrrolo[3,2-b]pyridine (PubChem CID 135062928) has the molecular formula C14H10I2N2O and a molecular weight of 476.06 g/mol. Its IUPAC name is 2,3-diiodo-5-phenylmethoxy-1H-pyrrolo[3,2-b]pyridine.
| Compound Name | 2,3-diiodo-5-phenylmethoxy-1H-pyrrolo[3,2-b]pyridine |
|---|---|
| PubChem CID | 135062928 |
| Molecular Formula | C14H10I2N2O |
| Molecular Weight | 476.06 g/mol |
| Exact Mass | 475.89 |
| IUPAC Name | 2,3-diiodo-5-phenylmethoxy-1H-pyrrolo[3,2-b]pyridine |
| SMILES | Ic1[nH]c2ccc(OCc3ccccc3)nc2c1I |
| InChI | InChI=1S/C14H10I2N2O/c15-12-13-10(17-14(12)16)6-7-11(18-13)19-8-9-4-2-1-3-5-9/h1-7,17H,8H2 |
| InChIKey | TVFRLELKIZUJQC-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.06 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|