C24H29NO4 — CID 135063081
(E)-4-[benzyl(methyl)amino]-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methoxy-1-phenylbut-2-en-1-one (PubChem CID 135063081) has the molecular formula C24H29NO4 and a molecular weight of 395.50 g/mol. Its IUPAC name is (E)-4-[benzyl(methyl)amino]-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methoxy-1-phenylbut-2-en-1-one.
| Compound Name | (E)-4-[benzyl(methyl)amino]-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methoxy-1-phenylbut-2-en-1-one |
|---|---|
| PubChem CID | 135063081 |
| Molecular Formula | C24H29NO4 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | (E)-4-[benzyl(methyl)amino]-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methoxy-1-phenylbut-2-en-1-one |
| SMILES | CO/C(=C/C(=O)c1ccccc1)C([C@H]1COC(C)(C)O1)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C24H29NO4/c1-24(2)28-17-22(29-24)23(25(3)16-18-11-7-5-8-12-18)21(27-4)15-20(26)19-13-9-6-10-14-19/h5-15,22-23H,16-17H2,1-4H3/b21-15+/t22-,23?/m1/s1 |
| InChIKey | DRYSDEDWIUTGAK-DSJJWYIYSA-N |
| XLogP | 4.05 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|