C37H33N2O3P — CID 135064667
benzhydryl (4R,5R)-1-diphenylphosphoryl-5-methyl-5-(4-methylphenyl)-4H-imidazole-4-carboxylate (PubChem CID 135064667) has the molecular formula C37H33N2O3P and a molecular weight of 584.66 g/mol. Its IUPAC name is benzhydryl (4R,5R)-1-diphenylphosphoryl-5-methyl-5-(4-methylphenyl)-4H-imidazole-4-carboxylate.
| Compound Name | benzhydryl (4R,5R)-1-diphenylphosphoryl-5-methyl-5-(4-methylphenyl)-4H-imidazole-4-carboxylate |
|---|---|
| PubChem CID | 135064667 |
| Molecular Formula | C37H33N2O3P |
| Molecular Weight | 584.66 g/mol |
| Exact Mass | 584.22 |
| IUPAC Name | benzhydryl (4R,5R)-1-diphenylphosphoryl-5-methyl-5-(4-methylphenyl)-4H-imidazole-4-carboxylate |
| SMILES | Cc1ccc([C@]2(C)[C@H](C(=O)OC(c3ccccc3)c3ccccc3)N=CN2P(=O)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C37H33N2O3P/c1-28-23-25-31(26-24-28)37(2)35(36(40)42-34(29-15-7-3-8-16-29)30-17-9-4-10-18-30)38-27-39(37)43(41,32-19-11-5-12-20-32)33-21-13-6-14-22-33/h3-27,34-35H,1-2H3/t35-,37+/m0/s1 |
| InChIKey | SRTLZARMLYQFDA-YBZKQSBQSA-N |
| XLogP | 7.18 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.66 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|