C37H33N2O4P — CID 135064670
benzhydryl (4R,5R)-1-diphenylphosphoryl-5-(3-methoxyphenyl)-5-methyl-4H-imidazole-4-carboxylate (PubChem CID 135064670) has the molecular formula C37H33N2O4P and a molecular weight of 600.66 g/mol. Its IUPAC name is benzhydryl (4R,5R)-1-diphenylphosphoryl-5-(3-methoxyphenyl)-5-methyl-4H-imidazole-4-carboxylate.
| Compound Name | benzhydryl (4R,5R)-1-diphenylphosphoryl-5-(3-methoxyphenyl)-5-methyl-4H-imidazole-4-carboxylate |
|---|---|
| PubChem CID | 135064670 |
| Molecular Formula | C37H33N2O4P |
| Molecular Weight | 600.66 g/mol |
| Exact Mass | 600.22 |
| IUPAC Name | benzhydryl (4R,5R)-1-diphenylphosphoryl-5-(3-methoxyphenyl)-5-methyl-4H-imidazole-4-carboxylate |
| SMILES | COc1cccc([C@]2(C)[C@H](C(=O)OC(c3ccccc3)c3ccccc3)N=CN2P(=O)(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C37H33N2O4P/c1-37(30-20-15-21-31(26-30)42-2)35(36(40)43-34(28-16-7-3-8-17-28)29-18-9-4-10-19-29)38-27-39(37)44(41,32-22-11-5-12-23-32)33-24-13-6-14-25-33/h3-27,34-35H,1-2H3/t35-,37+/m0/s1 |
| InChIKey | MDCFTWKVPCZSFT-YBZKQSBQSA-N |
| XLogP | 6.88 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.66 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|