C28H31N2O4P — CID 132528043
propan-2-yl (4R,5S)-1-diphenylphosphoryl-5-(4-methoxyphenyl)-4,5-dimethylimidazole-4-carboxylate (PubChem CID 132528043) has the molecular formula C28H31N2O4P and a molecular weight of 490.54 g/mol. Its IUPAC name is propan-2-yl (4R,5S)-1-diphenylphosphoryl-5-(4-methoxyphenyl)-4,5-dimethylimidazole-4-carboxylate.
| Compound Name | propan-2-yl (4R,5S)-1-diphenylphosphoryl-5-(4-methoxyphenyl)-4,5-dimethylimidazole-4-carboxylate |
|---|---|
| PubChem CID | 132528043 |
| Molecular Formula | C28H31N2O4P |
| Molecular Weight | 490.54 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | propan-2-yl (4R,5S)-1-diphenylphosphoryl-5-(4-methoxyphenyl)-4,5-dimethylimidazole-4-carboxylate |
| SMILES | COc1ccc([C@]2(C)N(P(=O)(c3ccccc3)c3ccccc3)C=N[C@@]2(C)C(=O)OC(C)C)cc1 |
| InChI | InChI=1S/C28H31N2O4P/c1-21(2)34-26(31)27(3)28(4,22-16-18-23(33-5)19-17-22)30(20-29-27)35(32,24-12-8-6-9-13-24)25-14-10-7-11-15-25/h6-21H,1-5H3/t27-,28-/m0/s1 |
| InChIKey | MVQMUUGMCUARKZ-NSOVKSMOSA-N |
| XLogP | 4.89 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.54 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|