C22H25F3N2OSi — CID 135065630
trimethyl-[2-[[5-phenyl-4-[2-(trifluoromethyl)phenyl]pyrazol-1-yl]methoxy]ethyl]silane (PubChem CID 135065630) has the molecular formula C22H25F3N2OSi and a molecular weight of 418.54 g/mol. Its IUPAC name is trimethyl-[2-[[5-phenyl-4-[2-(trifluoromethyl)phenyl]pyrazol-1-yl]methoxy]ethyl]silane.
| Compound Name | trimethyl-[2-[[5-phenyl-4-[2-(trifluoromethyl)phenyl]pyrazol-1-yl]methoxy]ethyl]silane |
|---|---|
| PubChem CID | 135065630 |
| Molecular Formula | C22H25F3N2OSi |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | trimethyl-[2-[[5-phenyl-4-[2-(trifluoromethyl)phenyl]pyrazol-1-yl]methoxy]ethyl]silane |
| SMILES | C[Si](C)(C)CCOCn1ncc(-c2ccccc2C(F)(F)F)c1-c1ccccc1 |
| InChI | InChI=1S/C22H25F3N2OSi/c1-29(2,3)14-13-28-16-27-21(17-9-5-4-6-10-17)19(15-26-27)18-11-7-8-12-20(18)22(23,24)25/h4-12,15H,13-14,16H2,1-3H3 |
| InChIKey | RZLPGIJZWUGBSC-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|