C16H21F3N2OSi — CID 135072326
trimethyl-[2-[[4-[2-(trifluoromethyl)phenyl]pyrazol-1-yl]methoxy]ethyl]silane (PubChem CID 135072326) has the molecular formula C16H21F3N2OSi and a molecular weight of 342.44 g/mol. Its IUPAC name is trimethyl-[2-[[4-[2-(trifluoromethyl)phenyl]pyrazol-1-yl]methoxy]ethyl]silane.
| Compound Name | trimethyl-[2-[[4-[2-(trifluoromethyl)phenyl]pyrazol-1-yl]methoxy]ethyl]silane |
|---|---|
| PubChem CID | 135072326 |
| Molecular Formula | C16H21F3N2OSi |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | trimethyl-[2-[[4-[2-(trifluoromethyl)phenyl]pyrazol-1-yl]methoxy]ethyl]silane |
| SMILES | C[Si](C)(C)CCOCn1cc(-c2ccccc2C(F)(F)F)cn1 |
| InChI | InChI=1S/C16H21F3N2OSi/c1-23(2,3)9-8-22-12-21-11-13(10-20-21)14-6-4-5-7-15(14)16(17,18)19/h4-7,10-11H,8-9,12H2,1-3H3 |
| InChIKey | KZBSQIKAUWKZCY-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|