C19H20N2O4S2 — CID 135066481
3,5-dimethyl-1,4-bis[(2-methylphenyl)sulfonyl]pyrazole (PubChem CID 135066481) has the molecular formula C19H20N2O4S2 and a molecular weight of 404.51 g/mol. Its IUPAC name is 3,5-dimethyl-1,4-bis[(2-methylphenyl)sulfonyl]pyrazole.
| Compound Name | 3,5-dimethyl-1,4-bis[(2-methylphenyl)sulfonyl]pyrazole |
|---|---|
| PubChem CID | 135066481 |
| Molecular Formula | C19H20N2O4S2 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | 3,5-dimethyl-1,4-bis[(2-methylphenyl)sulfonyl]pyrazole |
| SMILES | Cc1ccccc1S(=O)(=O)c1c(C)nn(S(=O)(=O)c2ccccc2C)c1C |
| InChI | InChI=1S/C19H20N2O4S2/c1-13-9-5-7-11-17(13)26(22,23)19-15(3)20-21(16(19)4)27(24,25)18-12-8-6-10-14(18)2/h5-12H,1-4H3 |
| InChIKey | WDWYBZRBAVPCAE-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 86.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |