C17H17NO4 — CID 135066606
(4R)-3-[(1S,5S)-6-methyl-3-oxo-8-oxabicyclo[3.2.1]oct-6-en-2-yl]-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 135066606) has the molecular formula C17H17NO4 and a molecular weight of 299.33 g/mol. Its IUPAC name is (4R)-3-[(1S,5S)-6-methyl-3-oxo-8-oxabicyclo[3.2.1]oct-6-en-2-yl]-4-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4R)-3-[(1S,5S)-6-methyl-3-oxo-8-oxabicyclo[3.2.1]oct-6-en-2-yl]-4-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 135066606 |
| Molecular Formula | C17H17NO4 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | (4R)-3-[(1S,5S)-6-methyl-3-oxo-8-oxabicyclo[3.2.1]oct-6-en-2-yl]-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | CC1=C[C@@H]2O[C@H]1CC(=O)C2N1C(=O)OC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C17H17NO4/c1-10-7-15-16(13(19)8-14(10)22-15)18-12(9-21-17(18)20)11-5-3-2-4-6-11/h2-7,12,14-16H,8-9H2,1H3/t12-,14-,15-,16?/m0/s1 |
| InChIKey | LMTNETVOYZAFOA-UGEFFSKSSA-N |
| XLogP | 2.23 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|