C15H16Cl2O — CID 135066870
1-[(Z)-1,2-dichloroethenoxy]-2-hept-1-ynylbenzene (PubChem CID 135066870) has the molecular formula C15H16Cl2O and a molecular weight of 283.20 g/mol. Its IUPAC name is 1-[(Z)-1,2-dichloroethenoxy]-2-hept-1-ynylbenzene.
| Compound Name | 1-[(Z)-1,2-dichloroethenoxy]-2-hept-1-ynylbenzene |
|---|---|
| PubChem CID | 135066870 |
| Molecular Formula | C15H16Cl2O |
| Molecular Weight | 283.20 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 1-[(Z)-1,2-dichloroethenoxy]-2-hept-1-ynylbenzene |
| SMILES | CCCCCC#Cc1ccccc1O/C(Cl)=C/Cl |
| InChI | InChI=1S/C15H16Cl2O/c1-2-3-4-5-6-9-13-10-7-8-11-14(13)18-15(17)12-16/h7-8,10-12H,2-5H2,1H3/b15-12+ |
| InChIKey | LPKCZEJPCMTTLY-NTCAYCPXSA-N |
| XLogP | 5.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.20 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|